C29H28N6S — CID 145254612
5-[(2E,4E)-5-(pyrrolidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]-3-(4-thiophen-2-yl-1H-pyrrolo[2,3-c]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridine (PubChem CID 145254612) has the molecular formula C29H28N6S and a molecular weight of 492.65 g/mol. Its IUPAC name is 5-[(2E,4E)-5-(pyrrolidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]-3-(4-thiophen-2-yl-1H-pyrrolo[2,3-c]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridine.
| Compound Name | 5-[(2E,4E)-5-(pyrrolidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]-3-(4-thiophen-2-yl-1H-pyrrolo[2,3-c]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 145254612 |
| Molecular Formula | C29H28N6S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 5-[(2E,4E)-5-(pyrrolidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]-3-(4-thiophen-2-yl-1H-pyrrolo[2,3-c]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3cc4c(-c5cccs5)cncc4[nH]3)c2n1)CN1CCCC1 |
| InChI | InChI=1S/C29H28N6S/c1-3-19(18-35-11-5-6-12-35)14-20(4-2)23-9-10-24-28(32-23)29(34-33-24)25-15-21-22(27-8-7-13-36-27)16-30-17-26(21)31-25/h3-4,7-10,13-17,31H,1,5-6,11-12,18H2,2H3,(H,33,34)/b19-14+,20-4+ |
| InChIKey | TWKNHYXELCSSIF-AWDHPMJCSA-N |
| XLogP | 6.84 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|