C28H24FN5 — CID 145254288
5-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]-3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridine (PubChem CID 145254288) has the molecular formula C28H24FN5 and a molecular weight of 449.53 g/mol. Its IUPAC name is 5-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]-3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridine.
| Compound Name | 5-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]-3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 145254288 |
| Molecular Formula | C28H24FN5 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 5-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]-3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3cc4c(-c5cccc(F)c5)cncc4[nH]3)c2n1)CC |
| InChI | InChI=1S/C28H24FN5/c1-4-17(5-2)12-18(6-3)23-10-11-24-27(32-23)28(34-33-24)25-14-21-22(15-30-16-26(21)31-25)19-8-7-9-20(29)13-19/h4,6-16,31H,1,5H2,2-3H3,(H,33,34)/b17-12+,18-6+ |
| InChIKey | DNMVZGDWWIJCJX-PKQVNZEUSA-N |
| XLogP | 7.23 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|