C29H25FN4 — CID 145252154
2-[5-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]-1H-indazol-3-yl]-4-(3-fluorophenyl)-1H-pyrrolo[3,2-c]pyridine (PubChem CID 145252154) has the molecular formula C29H25FN4 and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-[5-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]-1H-indazol-3-yl]-4-(3-fluorophenyl)-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 2-[5-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]-1H-indazol-3-yl]-4-(3-fluorophenyl)-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 145252154 |
| Molecular Formula | C29H25FN4 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-[5-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]-1H-indazol-3-yl]-4-(3-fluorophenyl)-1H-pyrrolo[3,2-c]pyridine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3cc4c(-c5cccc(F)c5)nccc4[nH]3)c2c1)CC |
| InChI | InChI=1S/C29H25FN4/c1-4-18(5-2)14-19(6-3)20-10-11-26-23(16-20)29(34-33-26)27-17-24-25(32-27)12-13-31-28(24)21-8-7-9-22(30)15-21/h4,6-17,32H,1,5H2,2-3H3,(H,33,34)/b18-14+,19-6+ |
| InChIKey | XETNVNALIKHQOD-KIRXAYOUSA-N |
| XLogP | 7.84 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|