C29H27FN6 — CID 145246281
(2E,4E)-2-ethenyl-4-[3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[3,4-c]pyridin-5-yl]-N,N-dimethylhexa-2,4-dien-1-amine (PubChem CID 145246281) has the molecular formula C29H27FN6 and a molecular weight of 478.58 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-4-[3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[3,4-c]pyridin-5-yl]-N,N-dimethylhexa-2,4-dien-1-amine.
| Compound Name | (2E,4E)-2-ethenyl-4-[3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[3,4-c]pyridin-5-yl]-N,N-dimethylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 145246281 |
| Molecular Formula | C29H27FN6 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (2E,4E)-2-ethenyl-4-[3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[3,4-c]pyridin-5-yl]-N,N-dimethylhexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\C(=C/C)c1cc2c(-c3cc4c(-c5cccc(F)c5)cncc4[nH]3)n[nH]c2cn1)CN(C)C |
| InChI | InChI=1S/C29H27FN6/c1-5-18(17-36(3)4)10-19(6-2)25-13-23-28(16-32-25)34-35-29(23)26-12-22-24(14-31-15-27(22)33-26)20-8-7-9-21(30)11-20/h5-16,33H,1,17H2,2-4H3,(H,34,35)/b18-10+,19-6+ |
| InChIKey | MSVWLOUQZNUHES-XZOHVCNOSA-N |
| XLogP | 6.38 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|