C35H29FN6 — CID 145250956
(3E,5E)-5-[3-[4-(3-fluorophenyl)-1H-pyrrolo[3,2-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-(3-phenylprop-1-en-2-yl)hepta-1,3,5-trien-3-amine (PubChem CID 145250956) has the molecular formula C35H29FN6 and a molecular weight of 552.66 g/mol. Its IUPAC name is (3E,5E)-5-[3-[4-(3-fluorophenyl)-1H-pyrrolo[3,2-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-(3-phenylprop-1-en-2-yl)hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-5-[3-[4-(3-fluorophenyl)-1H-pyrrolo[3,2-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-(3-phenylprop-1-en-2-yl)hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145250956 |
| Molecular Formula | C35H29FN6 |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | (3E,5E)-5-[3-[4-(3-fluorophenyl)-1H-pyrrolo[3,2-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-(3-phenylprop-1-en-2-yl)hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3cc4c(-c5cccc(F)c5)nccc4[nH]3)c2n1)NC(=C)Cc1ccccc1 |
| InChI | InChI=1S/C35H29FN6/c1-4-24(20-27(5-2)38-22(3)18-23-10-7-6-8-11-23)29-14-15-31-34(40-29)35(42-41-31)32-21-28-30(39-32)16-17-37-33(28)25-12-9-13-26(36)19-25/h4-17,19-21,38-39H,2-3,18H2,1H3,(H,41,42)/b24-4+,27-20+ |
| InChIKey | QDRHYLXFKXSIAA-GTAIZDFNSA-N |
| XLogP | 8.13 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|