C33H33FN6 — CID 145249622
(3E,5E)-N-(4,4-dimethylpent-1-en-2-yl)-5-[3-[4-(4-fluorophenyl)-1H-benzimidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine (PubChem CID 145249622) has the molecular formula C33H33FN6 and a molecular weight of 532.67 g/mol. Its IUPAC name is (3E,5E)-N-(4,4-dimethylpent-1-en-2-yl)-5-[3-[4-(4-fluorophenyl)-1H-benzimidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N-(4,4-dimethylpent-1-en-2-yl)-5-[3-[4-(4-fluorophenyl)-1H-benzimidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145249622 |
| Molecular Formula | C33H33FN6 |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | (3E,5E)-N-(4,4-dimethylpent-1-en-2-yl)-5-[3-[4-(4-fluorophenyl)-1H-benzimidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3nc4c(-c5ccc(F)cc5)cccc4[nH]3)c2n1)NC(=C)CC(C)(C)C |
| InChI | InChI=1S/C33H33FN6/c1-7-21(18-24(8-2)35-20(3)19-33(4,5)6)26-16-17-28-30(36-26)31(40-39-28)32-37-27-11-9-10-25(29(27)38-32)22-12-14-23(34)15-13-22/h7-18,35H,2-3,19H2,1,4-6H3,(H,37,38)(H,39,40)/b21-7+,24-18+ |
| InChIKey | AJLLDDNCAPVUPM-MTBADJBLSA-N |
| XLogP | 8.32 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|