C28H27N7S — CID 145253415
(3E,5E)-N-pent-1-en-2-yl-5-[3-(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine (PubChem CID 145253415) has the molecular formula C28H27N7S and a molecular weight of 493.64 g/mol. Its IUPAC name is (3E,5E)-N-pent-1-en-2-yl-5-[3-(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N-pent-1-en-2-yl-5-[3-(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145253415 |
| Molecular Formula | C28H27N7S |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (3E,5E)-N-pent-1-en-2-yl-5-[3-(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3nc4nccc(-c5cccs5)c4[nH]3)c2n1)NC(=C)CCC |
| InChI | InChI=1S/C28H27N7S/c1-5-9-17(4)30-19(7-3)16-18(6-2)21-11-12-22-25(31-21)26(35-34-22)28-32-24-20(23-10-8-15-36-23)13-14-29-27(24)33-28/h6-8,10-16,30H,3-5,9H2,1-2H3,(H,34,35)(H,29,32,33)/b18-6+,19-16+ |
| InChIKey | DDZBBIKBZFOVOU-NCMNCINPSA-N |
| XLogP | 7.00 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|