C26H25N7S — CID 137032942
(2E,4E)-2-ethenyl-N,N-dimethyl-4-[3-(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridin-5-yl]hexa-2,4-dien-1-amine (PubChem CID 137032942) has the molecular formula C26H25N7S and a molecular weight of 467.60 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-N,N-dimethyl-4-[3-(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridin-5-yl]hexa-2,4-dien-1-amine.
| Compound Name | (2E,4E)-2-ethenyl-N,N-dimethyl-4-[3-(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridin-5-yl]hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 137032942 |
| Molecular Formula | C26H25N7S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (2E,4E)-2-ethenyl-N,N-dimethyl-4-[3-(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridin-5-yl]hexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3nc4nccc(-c5cccs5)c4[nH]3)c2n1)CN(C)C |
| InChI | InChI=1S/C26H25N7S/c1-5-16(15-33(3)4)14-17(6-2)19-9-10-20-23(28-19)24(32-31-20)26-29-22-18(21-8-7-13-34-21)11-12-27-25(22)30-26/h5-14H,1,15H2,2-4H3,(H,31,32)(H,27,29,30)/b16-14+,17-6+ |
| InChIKey | HYFWCKXARHBJSH-GVJAGFTGSA-N |
| XLogP | 5.70 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|