C30H28ClN7S — CID 145244769
(3E,5E)-5-[3-[4-(5-chlorothiophen-2-yl)-1H-imidazo[4,5-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-(1-cyclopropylidenebutyl)hepta-1,3,5-trien-3-amine (PubChem CID 145244769) has the molecular formula C30H28ClN7S and a molecular weight of 554.12 g/mol. Its IUPAC name is (3E,5E)-5-[3-[4-(5-chlorothiophen-2-yl)-1H-imidazo[4,5-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-(1-cyclopropylidenebutyl)hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-5-[3-[4-(5-chlorothiophen-2-yl)-1H-imidazo[4,5-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-(1-cyclopropylidenebutyl)hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145244769 |
| Molecular Formula | C30H28ClN7S |
| Molecular Weight | 554.12 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | (3E,5E)-5-[3-[4-(5-chlorothiophen-2-yl)-1H-imidazo[4,5-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-(1-cyclopropylidenebutyl)hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3nc4c(-c5ccc(Cl)s5)nccc4[nH]3)c2n1)NC(CCC)=C1CC1 |
| InChI | InChI=1S/C30H28ClN7S/c1-4-7-20(18-8-9-18)33-19(6-3)16-17(5-2)21-10-11-23-27(34-21)29(38-37-23)30-35-22-14-15-32-28(26(22)36-30)24-12-13-25(31)39-24/h5-6,10-16,33H,3-4,7-9H2,1-2H3,(H,35,36)(H,37,38)/b17-5+,19-16+ |
| InChIKey | SAQXJRHGJSBPMR-UFNDXXBESA-N |
| XLogP | 8.19 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.12 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|