C30H31N5S — CID 145036808
acetylene;4-[(2E,4E)-5-(but-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-2-[(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)methyl]aniline (PubChem CID 145036808) has the molecular formula C30H31N5S and a molecular weight of 493.68 g/mol. Its IUPAC name is acetylene;4-[(2E,4E)-5-(but-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-2-[(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)methyl]aniline.
| Compound Name | acetylene;4-[(2E,4E)-5-(but-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-2-[(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 145036808 |
| Molecular Formula | C30H31N5S |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | acetylene;4-[(2E,4E)-5-(but-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-2-[(7-thiophen-2-yl-1H-imidazo[4,5-b]pyridin-2-yl)methyl]aniline |
| SMILES | C#C.C=C/C(=C\C(=C/C)c1ccc(N)c(Cc2nc3nccc(-c4cccs4)c3[nH]2)c1)NC(=C)CC |
| InChI | InChI=1S/C28H29N5S.C2H2/c1-5-18(4)31-22(7-3)16-19(6-2)20-10-11-24(29)21(15-20)17-26-32-27-23(25-9-8-14-34-25)12-13-30-28(27)33-26;1-2/h6-16,31H,3-5,17,29H2,1-2H3,(H,30,32,33);1-2H/b19-6+,22-16+; |
| InChIKey | YVJRPAUCOSCBGJ-KNEWUKSBSA-N |
| XLogP | 7.10 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|