C34H31N5S — CID 145308313
4-[(2E,4E)-5-(3-phenylprop-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-2-[1-(7-thiophen-3-yl-3H-imidazo[4,5-c]pyridin-2-yl)ethenyl]aniline (PubChem CID 145308313) has the molecular formula C34H31N5S and a molecular weight of 541.72 g/mol. Its IUPAC name is 4-[(2E,4E)-5-(3-phenylprop-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-2-[1-(7-thiophen-3-yl-3H-imidazo[4,5-c]pyridin-2-yl)ethenyl]aniline.
| Compound Name | 4-[(2E,4E)-5-(3-phenylprop-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-2-[1-(7-thiophen-3-yl-3H-imidazo[4,5-c]pyridin-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 145308313 |
| Molecular Formula | C34H31N5S |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 4-[(2E,4E)-5-(3-phenylprop-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-2-[1-(7-thiophen-3-yl-3H-imidazo[4,5-c]pyridin-2-yl)ethenyl]aniline |
| SMILES | C=C/C(=C\C(=C/C)c1ccc(N)c(C(=C)c2nc3c(-c4ccsc4)cncc3[nH]2)c1)NC(=C)Cc1ccccc1 |
| InChI | InChI=1S/C34H31N5S/c1-5-25(17-28(6-2)37-22(3)16-24-10-8-7-9-11-24)26-12-13-31(35)29(18-26)23(4)34-38-32-20-36-19-30(33(32)39-34)27-14-15-40-21-27/h5-15,17-21,37H,2-4,16,35H2,1H3,(H,38,39)/b25-5+,28-17+ |
| InChIKey | JBIDARAQYIHWBL-ILVSVMGTSA-N |
| XLogP | 8.15 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|