C33H34FN5 — CID 145308584
2-[1-[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]-4-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]aniline (PubChem CID 145308584) has the molecular formula C33H34FN5 and a molecular weight of 519.67 g/mol. Its IUPAC name is 2-[1-[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]-4-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]aniline.
| Compound Name | 2-[1-[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]-4-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]aniline |
|---|---|
| PubChem CID | 145308584 |
| Molecular Formula | C33H34FN5 |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | 2-[1-[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]-4-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]aniline |
| SMILES | C=C/C(=C\C(=C/C)c1ccc(N)c(C(=C)c2nc3c(-c4ccc(F)cc4)cncc3[nH]2)c1)CN1CCCCC1 |
| InChI | InChI=1S/C33H34FN5/c1-4-23(21-39-15-7-6-8-16-39)17-24(5-2)26-11-14-30(35)28(18-26)22(3)33-37-31-20-36-19-29(32(31)38-33)25-9-12-27(34)13-10-25/h4-5,9-14,17-20H,1,3,6-8,15-16,21,35H2,2H3,(H,37,38)/b23-17+,24-5+ |
| InChIKey | FFVJFOFSRGWQIP-AAPLWDASSA-N |
| XLogP | 7.41 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|