C27H26N4S — CID 145308495
4-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]-2-[1-[7-(5-methylthiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]aniline (PubChem CID 145308495) has the molecular formula C27H26N4S and a molecular weight of 438.60 g/mol. Its IUPAC name is 4-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]-2-[1-[7-(5-methylthiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]aniline.
| Compound Name | 4-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]-2-[1-[7-(5-methylthiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 145308495 |
| Molecular Formula | C27H26N4S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 4-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]-2-[1-[7-(5-methylthiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]aniline |
| SMILES | C=C/C=C(C)\C(=C/C)c1ccc(N)c(C(=C)c2nc3c(-c4ccc(C)s4)cncc3[nH]2)c1 |
| InChI | InChI=1S/C27H26N4S/c1-6-8-16(3)20(7-2)19-10-11-23(28)21(13-19)18(5)27-30-24-15-29-14-22(26(24)31-27)25-12-9-17(4)32-25/h6-15H,1,5,28H2,2-4H3,(H,30,31)/b16-8-,20-7+ |
| InChIKey | SXRVNYCTSWCWBW-OSIIHKIMSA-N |
| XLogP | 7.17 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|