C33H32FN5 — CID 145308275
4-[(2E,4E)-5-(1-cyclobutylethenylamino)hepta-2,4,6-trien-3-yl]-2-[1-[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]aniline (PubChem CID 145308275) has the molecular formula C33H32FN5 and a molecular weight of 517.65 g/mol. Its IUPAC name is 4-[(2E,4E)-5-(1-cyclobutylethenylamino)hepta-2,4,6-trien-3-yl]-2-[1-[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]aniline.
| Compound Name | 4-[(2E,4E)-5-(1-cyclobutylethenylamino)hepta-2,4,6-trien-3-yl]-2-[1-[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 145308275 |
| Molecular Formula | C33H32FN5 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 4-[(2E,4E)-5-(1-cyclobutylethenylamino)hepta-2,4,6-trien-3-yl]-2-[1-[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]ethenyl]aniline |
| SMILES | C=C/C(=C\C(=C/C)c1ccc(N)c(C(=C)c2nc3c(-c4ccc(F)cc4)cncc3[nH]2)c1)NC(=C)C1CCC1 |
| InChI | InChI=1S/C33H32FN5/c1-5-22(16-27(6-2)37-21(4)23-8-7-9-23)25-12-15-30(35)28(17-25)20(3)33-38-31-19-36-18-29(32(31)39-33)24-10-13-26(34)14-11-24/h5-6,10-19,23,37H,2-4,7-9,35H2,1H3,(H,38,39)/b22-5+,27-16+ |
| InChIKey | OSBZOZBHXLPYID-QCODINICSA-N |
| XLogP | 7.78 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|