C32H33FN6 — CID 145037405
N-(1-cyclobutylethenyl)-5-[(3Z,5E)-4-[[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-5-(methylamino)hepta-1,3,5-trien-2-yl]pyridin-3-amine (PubChem CID 145037405) has the molecular formula C32H33FN6 and a molecular weight of 520.66 g/mol. Its IUPAC name is N-(1-cyclobutylethenyl)-5-[(3Z,5E)-4-[[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-5-(methylamino)hepta-1,3,5-trien-2-yl]pyridin-3-amine.
| Compound Name | N-(1-cyclobutylethenyl)-5-[(3Z,5E)-4-[[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-5-(methylamino)hepta-1,3,5-trien-2-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 145037405 |
| Molecular Formula | C32H33FN6 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | N-(1-cyclobutylethenyl)-5-[(3Z,5E)-4-[[7-(4-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-5-(methylamino)hepta-1,3,5-trien-2-yl]pyridin-3-amine |
| SMILES | C=C(/C=C(Cc1nc2c(-c3ccc(F)cc3)cncc2[nH]1)\C(=C/C)NC)c1cncc(NC(=C)C2CCC2)c1 |
| InChI | InChI=1S/C32H33FN6/c1-5-29(34-4)24(13-20(2)25-14-27(17-35-16-25)37-21(3)22-7-6-8-22)15-31-38-30-19-36-18-28(32(30)39-31)23-9-11-26(33)12-10-23/h5,9-14,16-19,22,34,37H,2-3,6-8,15H2,1,4H3,(H,38,39)/b24-13-,29-5+ |
| InChIKey | ZZMSTYCYHNKXOV-CQQQLZJLSA-N |
| XLogP | 7.19 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|