C34H37N5S — CID 145308286
4-[(2E,4E)-5-(1-cyclobutylethenylamino)hepta-2,4,6-trien-3-yl]-N-methyl-2-[[7-(5-prop-1-en-2-ylthiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]aniline (PubChem CID 145308286) has the molecular formula C34H37N5S and a molecular weight of 547.77 g/mol. Its IUPAC name is 4-[(2E,4E)-5-(1-cyclobutylethenylamino)hepta-2,4,6-trien-3-yl]-N-methyl-2-[[7-(5-prop-1-en-2-ylthiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]aniline.
| Compound Name | 4-[(2E,4E)-5-(1-cyclobutylethenylamino)hepta-2,4,6-trien-3-yl]-N-methyl-2-[[7-(5-prop-1-en-2-ylthiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 145308286 |
| Molecular Formula | C34H37N5S |
| Molecular Weight | 547.77 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 4-[(2E,4E)-5-(1-cyclobutylethenylamino)hepta-2,4,6-trien-3-yl]-N-methyl-2-[[7-(5-prop-1-en-2-ylthiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]aniline |
| SMILES | C=C/C(=C\C(=C/C)c1ccc(NC)c(Cc2nc3c(-c4ccc(C(=C)C)s4)cncc3[nH]2)c1)NC(=C)C1CCC1 |
| InChI | InChI=1S/C34H37N5S/c1-7-23(17-27(8-2)37-22(5)24-10-9-11-24)25-12-13-29(35-6)26(16-25)18-33-38-30-20-36-19-28(34(30)39-33)32-15-14-31(40-32)21(3)4/h7-8,12-17,19-20,24,35,37H,2-3,5,9-11,18H2,1,4,6H3,(H,38,39)/b23-7+,27-17+ |
| InChIKey | IYQAWSJWXDCULS-HQYARDDOSA-N |
| XLogP | 8.73 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.77 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|