C37H44FN5 — CID 145253326
N-(1-cyclohexylethenyl)-5-[(2E,4E)-6-[[4-[(1Z)-1-(3-fluoro-5-methylphenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]-5-(methylamino)hepta-2,4,6-trien-2-yl]pyridin-3-amine (PubChem CID 145253326) has the molecular formula C37H44FN5 and a molecular weight of 577.79 g/mol. Its IUPAC name is N-(1-cyclohexylethenyl)-5-[(2E,4E)-6-[[4-[(1Z)-1-(3-fluoro-5-methylphenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]-5-(methylamino)hepta-2,4,6-trien-2-yl]pyridin-3-amine.
| Compound Name | N-(1-cyclohexylethenyl)-5-[(2E,4E)-6-[[4-[(1Z)-1-(3-fluoro-5-methylphenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]-5-(methylamino)hepta-2,4,6-trien-2-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 145253326 |
| Molecular Formula | C37H44FN5 |
| Molecular Weight | 577.79 g/mol |
| Exact Mass | 577.36 |
| IUPAC Name | N-(1-cyclohexylethenyl)-5-[(2E,4E)-6-[[4-[(1Z)-1-(3-fluoro-5-methylphenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]-5-(methylamino)hepta-2,4,6-trien-2-yl]pyridin-3-amine |
| SMILES | C=C/C=C(/c1cc(C)cc(F)c1)c1nc(CC(=C)/C(=C\C=C(/C)c2cncc(NC(=C)C3CCCCC3)c2)NC)[nH]c1C |
| InChI | InChI=1S/C37H44FN5/c1-8-12-34(30-17-24(2)18-32(38)20-30)37-28(6)42-36(43-37)19-26(4)35(39-7)16-15-25(3)31-21-33(23-40-22-31)41-27(5)29-13-10-9-11-14-29/h8,12,15-18,20-23,29,39,41H,1,4-5,9-11,13-14,19H2,2-3,6-7H3,(H,42,43)/b25-15+,34-12-,35-16+ |
| InChIKey | DSRWOUWIXFNXJI-XZNPCCBOSA-N |
| XLogP | 8.99 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.79 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|