C32H37N5 — CID 154655003
4-N-(1-cyclopropylethenyl)-3-N-[1-[3-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-8-yl]ethenyl]pyridine-3,4-diamine (PubChem CID 154655003) has the molecular formula C32H37N5 and a molecular weight of 491.68 g/mol. Its IUPAC name is 4-N-(1-cyclopropylethenyl)-3-N-[1-[3-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-8-yl]ethenyl]pyridine-3,4-diamine.
| Compound Name | 4-N-(1-cyclopropylethenyl)-3-N-[1-[3-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-8-yl]ethenyl]pyridine-3,4-diamine |
|---|---|
| PubChem CID | 154655003 |
| Molecular Formula | C32H37N5 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 4-N-(1-cyclopropylethenyl)-3-N-[1-[3-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]-7-azabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-8-yl]ethenyl]pyridine-3,4-diamine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2c(c1)C(C(=C)Nc1cnccc1NC(=C)C1CC1)=N2)CN1CCCCC1 |
| InChI | InChI=1S/C32H37N5/c1-5-24(21-37-16-8-7-9-17-37)18-25(6-2)27-12-13-29-28(19-27)32(36-29)23(4)35-31-20-33-15-14-30(31)34-22(3)26-10-11-26/h5-6,12-15,18-20,26,35H,1,3-4,7-11,16-17,21H2,2H3,(H,33,34)/b24-18+,25-6+ |
| InChIKey | GLDADAREFFFKCF-GVIWPKLQSA-N |
| XLogP | 7.48 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|