C37H43FN4S — CID 145036060
N-[3-[4-fluoro-2-(methylamino)-5-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]phenyl]buta-1,3-dien-2-yl]-3-methyl-4-(5-prop-1-en-2-ylthiophen-2-yl)pyridin-2-amine (PubChem CID 145036060) has the molecular formula C37H43FN4S and a molecular weight of 594.84 g/mol. Its IUPAC name is N-[3-[4-fluoro-2-(methylamino)-5-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]phenyl]buta-1,3-dien-2-yl]-3-methyl-4-(5-prop-1-en-2-ylthiophen-2-yl)pyridin-2-amine.
| Compound Name | N-[3-[4-fluoro-2-(methylamino)-5-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]phenyl]buta-1,3-dien-2-yl]-3-methyl-4-(5-prop-1-en-2-ylthiophen-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 145036060 |
| Molecular Formula | C37H43FN4S |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | N-[3-[4-fluoro-2-(methylamino)-5-[(2E,4E)-5-(piperidin-1-ylmethyl)hepta-2,4,6-trien-3-yl]phenyl]buta-1,3-dien-2-yl]-3-methyl-4-(5-prop-1-en-2-ylthiophen-2-yl)pyridin-2-amine |
| SMILES | C=C/C(=C\C(=C/C)c1cc(C(=C)C(=C)Nc2nccc(-c3ccc(C(=C)C)s3)c2C)c(NC)cc1F)CN1CCCCC1 |
| InChI | InChI=1S/C37H43FN4S/c1-9-28(23-42-18-12-11-13-19-42)20-29(10-2)32-21-31(34(39-8)22-33(32)38)25(5)27(7)41-37-26(6)30(16-17-40-37)36-15-14-35(43-36)24(3)4/h9-10,14-17,20-22,39H,1,3,5,7,11-13,18-19,23H2,2,4,6,8H3,(H,40,41)/b28-20+,29-10+ |
| InChIKey | QOEKFDUJAZYJSO-FLYZOFRHSA-N |
| XLogP | 9.97 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|