C35H39FN4 — CID 145035933
N-[3-[2-amino-5-[(2E,4E)-5-(3,3-dimethylbut-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]phenyl]buta-1,3-dien-2-yl]-4-(3-fluorophenyl)-3-methylpyridin-2-amine (PubChem CID 145035933) has the molecular formula C35H39FN4 and a molecular weight of 534.72 g/mol. Its IUPAC name is N-[3-[2-amino-5-[(2E,4E)-5-(3,3-dimethylbut-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]phenyl]buta-1,3-dien-2-yl]-4-(3-fluorophenyl)-3-methylpyridin-2-amine.
| Compound Name | N-[3-[2-amino-5-[(2E,4E)-5-(3,3-dimethylbut-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]phenyl]buta-1,3-dien-2-yl]-4-(3-fluorophenyl)-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 145035933 |
| Molecular Formula | C35H39FN4 |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | N-[3-[2-amino-5-[(2E,4E)-5-(3,3-dimethylbut-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]phenyl]buta-1,3-dien-2-yl]-4-(3-fluorophenyl)-3-methylpyridin-2-amine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc(N)c(C(=C)C(=C)Nc2nccc(-c3cccc(F)c3)c2C)c1)NC(=C)C(C)(C)C |
| InChI | InChI=1S/C35H39FN4/c1-10-26(20-30(11-2)40-25(6)35(7,8)9)27-15-16-33(37)32(21-27)22(3)24(5)39-34-23(4)31(17-18-38-34)28-13-12-14-29(36)19-28/h10-21,40H,2-3,5-6,37H2,1,4,7-9H3,(H,38,39)/b26-10+,30-20+ |
| InChIKey | QKKULQHYLQNVEI-OZFRNZSZSA-N |
| XLogP | 9.04 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|