C33H34FN5 — CID 145246588
(3E,5E)-5-[(3E)-3-[(5E)-5-ethylidene-3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1H-pyrazol-4-ylidene]prop-1-en-2-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine (PubChem CID 145246588) has the molecular formula C33H34FN5 and a molecular weight of 519.67 g/mol. Its IUPAC name is (3E,5E)-5-[(3E)-3-[(5E)-5-ethylidene-3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1H-pyrazol-4-ylidene]prop-1-en-2-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-5-[(3E)-3-[(5E)-5-ethylidene-3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1H-pyrazol-4-ylidene]prop-1-en-2-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145246588 |
| Molecular Formula | C33H34FN5 |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | (3E,5E)-5-[(3E)-3-[(5E)-5-ethylidene-3-[4-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-1H-pyrazol-4-ylidene]prop-1-en-2-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)C(=C)/C=c1/c(-c2cc3c(-c4cccc(F)c4)ccnc3[nH]2)n[nH]/c1=C/C)NC(=C)CCC |
| InChI | InChI=1S/C33H34FN5/c1-7-12-22(6)36-26(9-3)19-23(8-2)21(5)17-29-30(10-4)38-39-32(29)31-20-28-27(15-16-35-33(28)37-31)24-13-11-14-25(34)18-24/h8-11,13-20,36,38H,3,5-7,12H2,1-2,4H3,(H,35,37)/b23-8+,26-19+,29-17+,30-10+ |
| InChIKey | BDMXEKJHHYYAAZ-MREWOLJOSA-N |
| XLogP | 6.82 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|