C32H34FN5 — CID 145251675
(2E,4E,5E,7E)-2-ethenyl-4-ethylidene-7-[3-[4-(3-fluoro-5-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-4-methylidene-1H-pyrazol-5-ylidene]-N,N,5-trimethylhepta-2,5-dien-1-amine (PubChem CID 145251675) has the molecular formula C32H34FN5 and a molecular weight of 507.66 g/mol. Its IUPAC name is (2E,4E,5E,7E)-2-ethenyl-4-ethylidene-7-[3-[4-(3-fluoro-5-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-4-methylidene-1H-pyrazol-5-ylidene]-N,N,5-trimethylhepta-2,5-dien-1-amine.
| Compound Name | (2E,4E,5E,7E)-2-ethenyl-4-ethylidene-7-[3-[4-(3-fluoro-5-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-4-methylidene-1H-pyrazol-5-ylidene]-N,N,5-trimethylhepta-2,5-dien-1-amine |
|---|---|
| PubChem CID | 145251675 |
| Molecular Formula | C32H34FN5 |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (2E,4E,5E,7E)-2-ethenyl-4-ethylidene-7-[3-[4-(3-fluoro-5-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-4-methylidene-1H-pyrazol-5-ylidene]-N,N,5-trimethylhepta-2,5-dien-1-amine |
| SMILES | C=C/C(=C\C(=C/C)\C(C)=C\C=c1\[nH]nc(-c2cc3c(-c4cc(C)cc(F)c4)ccnc3[nH]2)c1=C)CN(C)C |
| InChI | InChI=1S/C32H34FN5/c1-8-23(19-38(6)7)16-24(9-2)21(4)10-11-29-22(5)31(37-36-29)30-18-28-27(12-13-34-32(28)35-30)25-14-20(3)15-26(33)17-25/h8-18,36H,1,5,19H2,2-4,6-7H3,(H,34,35)/b21-10+,23-16+,24-9+,29-11+ |
| InChIKey | WRTOVZLHFCDSNZ-DKVKAZJMSA-N |
| XLogP | 5.82 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|