C32H33FN6 — CID 145250531
3-[4-(4-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-2-carboximidoyl]-5-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]pyridin-2-amine (PubChem CID 145250531) has the molecular formula C32H33FN6 and a molecular weight of 520.66 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-2-carboximidoyl]-5-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]pyridin-2-amine.
| Compound Name | 3-[4-(4-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-2-carboximidoyl]-5-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 145250531 |
| Molecular Formula | C32H33FN6 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 3-[4-(4-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-2-carboximidoyl]-5-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]pyridin-2-amine |
| SMILES | [H]/N=C(/c1cc2c(-c3ccc(F)cc3)ccnc2[nH]1)c1cc(C(/C=C(\C=C)NC(=C)CC(C)C)=C/C)cnc1N |
| InChI | InChI=1S/C32H33FN6/c1-6-21(15-25(7-2)38-20(5)14-19(3)4)23-16-28(31(35)37-18-23)30(34)29-17-27-26(12-13-36-32(27)39-29)22-8-10-24(33)11-9-22/h6-13,15-19,34,38H,2,5,14H2,1,3-4H3,(H2,35,37)(H,36,39)/b21-6+,25-15+,34-30+ |
| InChIKey | DZBIBXJLYIUFPH-SVXKSBCFSA-N |
| XLogP | 7.38 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|