C33H37N5 — CID 154655046
acetylene;5-[(2E,4E)-5-(ethenylamino)hepta-2,4,6-trien-3-yl]-3-[(4-pyridin-3-yl-1H-indol-2-yl)methyl]pyridin-2-amine;propane (PubChem CID 154655046) has the molecular formula C33H37N5 and a molecular weight of 503.69 g/mol. Its IUPAC name is acetylene;5-[(2E,4E)-5-(ethenylamino)hepta-2,4,6-trien-3-yl]-3-[(4-pyridin-3-yl-1H-indol-2-yl)methyl]pyridin-2-amine;propane.
| Compound Name | acetylene;5-[(2E,4E)-5-(ethenylamino)hepta-2,4,6-trien-3-yl]-3-[(4-pyridin-3-yl-1H-indol-2-yl)methyl]pyridin-2-amine;propane |
|---|---|
| PubChem CID | 154655046 |
| Molecular Formula | C33H37N5 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | acetylene;5-[(2E,4E)-5-(ethenylamino)hepta-2,4,6-trien-3-yl]-3-[(4-pyridin-3-yl-1H-indol-2-yl)methyl]pyridin-2-amine;propane |
| SMILES | C#C.C=CN/C(C=C)=C/C(=C\C)c1cnc(N)c(Cc2cc3c(-c4cccnc4)cccc3[nH]2)c1.CCC |
| InChI | InChI=1S/C28H27N5.C3H8.C2H2/c1-4-19(14-23(5-2)31-6-3)22-13-21(28(29)32-18-22)15-24-16-26-25(10-7-11-27(26)33-24)20-9-8-12-30-17-20;1-3-2;1-2/h4-14,16-18,31,33H,2-3,15H2,1H3,(H2,29,32);3H2,1-2H3;1-2H/b19-4+,23-14+;; |
| InChIKey | ZLPJUXWVIYYPHL-KUKXNPSUSA-N |
| XLogP | 7.67 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|