C35H30N6O — CID 145247992
N-[(1E,3E,5Z)-1-amino-2-[1-methyl-3-(4-pyridin-3-yl-1H-indol-2-yl)indazol-5-yl]hepta-1,3,5-trien-4-yl]benzamide (PubChem CID 145247992) has the molecular formula C35H30N6O and a molecular weight of 550.67 g/mol. Its IUPAC name is N-[(1E,3E,5Z)-1-amino-2-[1-methyl-3-(4-pyridin-3-yl-1H-indol-2-yl)indazol-5-yl]hepta-1,3,5-trien-4-yl]benzamide.
| Compound Name | N-[(1E,3E,5Z)-1-amino-2-[1-methyl-3-(4-pyridin-3-yl-1H-indol-2-yl)indazol-5-yl]hepta-1,3,5-trien-4-yl]benzamide |
|---|---|
| PubChem CID | 145247992 |
| Molecular Formula | C35H30N6O |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | N-[(1E,3E,5Z)-1-amino-2-[1-methyl-3-(4-pyridin-3-yl-1H-indol-2-yl)indazol-5-yl]hepta-1,3,5-trien-4-yl]benzamide |
| SMILES | C/C=C\C(=C/C(=C\N)c1ccc2c(c1)c(-c1cc3c(-c4cccnc4)cccc3[nH]1)nn2C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H30N6O/c1-3-9-27(38-35(42)23-10-5-4-6-11-23)18-26(21-36)24-15-16-33-30(19-24)34(40-41(33)2)32-20-29-28(13-7-14-31(29)39-32)25-12-8-17-37-22-25/h3-22,39H,36H2,1-2H3,(H,38,42)/b9-3-,26-21+,27-18+ |
| InChIKey | WVJRVPPZVJLSNF-GQWVJQONSA-N |
| XLogP | 6.97 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|