C30H27FN4O — CID 145248012
(1E,3E)-2-[3-[4-(3-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-4-methoxy-6-methylhepta-1,3,5-trien-1-amine (PubChem CID 145248012) has the molecular formula C30H27FN4O and a molecular weight of 478.57 g/mol. Its IUPAC name is (1E,3E)-2-[3-[4-(3-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-4-methoxy-6-methylhepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3E)-2-[3-[4-(3-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-4-methoxy-6-methylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 145248012 |
| Molecular Formula | C30H27FN4O |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | (1E,3E)-2-[3-[4-(3-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-4-methoxy-6-methylhepta-1,3,5-trien-1-amine |
| SMILES | CO/C(C=C(C)C)=C/C(=C\N)c1ccc2[nH]nc(-c3cc4c(-c5cccc(F)c5)cccc4[nH]3)c2c1 |
| InChI | InChI=1S/C30H27FN4O/c1-18(2)12-23(36-3)14-21(17-32)19-10-11-28-26(15-19)30(35-34-28)29-16-25-24(8-5-9-27(25)33-29)20-6-4-7-22(31)13-20/h4-17,33H,32H2,1-3H3,(H,34,35)/b21-17+,23-14+ |
| InChIKey | PDPJYCHCNQAERC-RRZUHXDGSA-N |
| XLogP | 7.31 |
| TPSA | 79.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|