C34H33FN4O — CID 145247989
N-[(2E,4E)-4-[3-[4-(2-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-7-methylocta-2,4,7-trien-2-yl]-2-methylpropanamide (PubChem CID 145247989) has the molecular formula C34H33FN4O and a molecular weight of 532.66 g/mol. Its IUPAC name is N-[(2E,4E)-4-[3-[4-(2-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-7-methylocta-2,4,7-trien-2-yl]-2-methylpropanamide.
| Compound Name | N-[(2E,4E)-4-[3-[4-(2-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-7-methylocta-2,4,7-trien-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 145247989 |
| Molecular Formula | C34H33FN4O |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | N-[(2E,4E)-4-[3-[4-(2-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-7-methylocta-2,4,7-trien-2-yl]-2-methylpropanamide |
| SMILES | C=C(C)C/C=C(\C=C(/C)NC(=O)C(C)C)c1ccc2[nH]nc(-c3cc4c(-c5ccccc5F)cccc4[nH]3)c2c1 |
| InChI | InChI=1S/C34H33FN4O/c1-20(2)13-14-23(17-22(5)36-34(40)21(3)4)24-15-16-31-28(18-24)33(39-38-31)32-19-27-25(10-8-12-30(27)37-32)26-9-6-7-11-29(26)35/h6-12,14-19,21,37H,1,13H2,2-5H3,(H,36,40)(H,38,39)/b22-17+,23-14+ |
| InChIKey | HMYCWSZWRDWOCZ-WQVKJCQJSA-N |
| XLogP | 8.54 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|