C32H33FN4 — CID 145245539
acetylene;5-[(2E,4E)-5-(dimethylamino)hepta-2,4,6-trien-3-yl]-3-[[4-(3-fluorophenyl)-1H-indol-2-yl]methyl]-N-methylpyridin-2-amine (PubChem CID 145245539) has the molecular formula C32H33FN4 and a molecular weight of 492.64 g/mol. Its IUPAC name is acetylene;5-[(2E,4E)-5-(dimethylamino)hepta-2,4,6-trien-3-yl]-3-[[4-(3-fluorophenyl)-1H-indol-2-yl]methyl]-N-methylpyridin-2-amine.
| Compound Name | acetylene;5-[(2E,4E)-5-(dimethylamino)hepta-2,4,6-trien-3-yl]-3-[[4-(3-fluorophenyl)-1H-indol-2-yl]methyl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 145245539 |
| Molecular Formula | C32H33FN4 |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | acetylene;5-[(2E,4E)-5-(dimethylamino)hepta-2,4,6-trien-3-yl]-3-[[4-(3-fluorophenyl)-1H-indol-2-yl]methyl]-N-methylpyridin-2-amine |
| SMILES | C#C.C=C/C(=C\C(=C/C)c1cnc(NC)c(Cc2cc3c(-c4cccc(F)c4)cccc3[nH]2)c1)N(C)C |
| InChI | InChI=1S/C30H31FN4.C2H2/c1-6-20(17-26(7-2)35(4)5)23-14-22(30(32-3)33-19-23)16-25-18-28-27(12-9-13-29(28)34-25)21-10-8-11-24(31)15-21;1-2/h6-15,17-19,34H,2,16H2,1,3-5H3,(H,32,33);1-2H/b20-6+,26-17+; |
| InChIKey | YBEIOKOXCMXOMI-NPTVRYRMSA-N |
| XLogP | 7.29 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|