C27H26N6S — CID 145248326
(3E,5E)-N,N-dimethyl-5-[3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[3,2-c]pyridin-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine (PubChem CID 145248326) has the molecular formula C27H26N6S and a molecular weight of 466.61 g/mol. Its IUPAC name is (3E,5E)-N,N-dimethyl-5-[3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[3,2-c]pyridin-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N,N-dimethyl-5-[3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[3,2-c]pyridin-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145248326 |
| Molecular Formula | C27H26N6S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (3E,5E)-N,N-dimethyl-5-[3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[3,2-c]pyridin-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)c1cnc2n[nH]c(-c3cc4c(-c5ccc(C)s5)nccc4[nH]3)c2c1)N(C)C |
| InChI | InChI=1S/C27H26N6S/c1-6-17(12-19(7-2)33(4)5)18-13-21-25(31-32-27(21)29-15-18)23-14-20-22(30-23)10-11-28-26(20)24-9-8-16(3)34-24/h6-15,30H,2H2,1,3-5H3,(H,29,31,32)/b17-6+,19-12+ |
| InChIKey | RGUBYBHAZXLIQS-IYZOSDGBSA-N |
| XLogP | 6.57 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|