C33H37FN8 — CID 145248592
N-[3-[2-[5-[(2E,4E)-5-(ethylaminomethyl)hepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-1H-pyrrolo[3,2-c]pyridin-4-yl]-5-fluorophenyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 145248592) has the molecular formula C33H37FN8 and a molecular weight of 564.71 g/mol. Its IUPAC name is N-[3-[2-[5-[(2E,4E)-5-(ethylaminomethyl)hepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-1H-pyrrolo[3,2-c]pyridin-4-yl]-5-fluorophenyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[3-[2-[5-[(2E,4E)-5-(ethylaminomethyl)hepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-1H-pyrrolo[3,2-c]pyridin-4-yl]-5-fluorophenyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 145248592 |
| Molecular Formula | C33H37FN8 |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | N-[3-[2-[5-[(2E,4E)-5-(ethylaminomethyl)hepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]-1H-pyrrolo[3,2-c]pyridin-4-yl]-5-fluorophenyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | C=C/C(=C\C(=C/C)c1cnc2n[nH]c(-c3cc4c(-c5cc(F)cc(NCCN(C)C)c5)nccc4[nH]3)c2c1)CNCC |
| InChI | InChI=1S/C33H37FN8/c1-6-21(19-35-8-3)13-22(7-2)24-16-28-32(40-41-33(28)38-20-24)30-18-27-29(39-30)9-10-37-31(27)23-14-25(34)17-26(15-23)36-11-12-42(4)5/h6-7,9-10,13-18,20,35-36,39H,1,8,11-12,19H2,2-5H3,(H,38,40,41)/b21-13+,22-7+ |
| InChIKey | IIJQFJFAIJQPJO-MWUAKDQNSA-N |
| XLogP | 6.41 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|