C25H21N5S — CID 145250400
5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-2H-pyrazolo[3,4-b]pyridine (PubChem CID 145250400) has the molecular formula C25H21N5S and a molecular weight of 423.55 g/mol. Its IUPAC name is 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 145250400 |
| Molecular Formula | C25H21N5S |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-2H-pyrazolo[3,4-b]pyridine |
| SMILES | C=C/C=C\C(=C/C)c1cnc2n[nH]c(-c3cc4c(-c5ccc(C)s5)ccnc4[nH]3)c2c1 |
| InChI | InChI=1S/C25H21N5S/c1-4-6-7-16(5-2)17-12-20-23(29-30-25(20)27-14-17)21-13-19-18(10-11-26-24(19)28-21)22-9-8-15(3)31-22/h4-14H,1H2,2-3H3,(H,26,28)(H,27,29,30)/b7-6-,16-5+ |
| InChIKey | KSIBBSVQFRKCMU-PIEALQRTSA-N |
| XLogP | 6.68 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|