C34H47N7 — CID 145038601
3-methyl-N-[3-[2-(methylamino)-5-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-3-pyridinyl]buta-1,3-dien-2-yl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine (PubChem CID 145038601) has the molecular formula C34H47N7 and a molecular weight of 553.80 g/mol. Its IUPAC name is 3-methyl-N-[3-[2-(methylamino)-5-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-3-pyridinyl]buta-1,3-dien-2-yl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine.
| Compound Name | 3-methyl-N-[3-[2-(methylamino)-5-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-3-pyridinyl]buta-1,3-dien-2-yl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 145038601 |
| Molecular Formula | C34H47N7 |
| Molecular Weight | 553.80 g/mol |
| Exact Mass | 553.39 |
| IUPAC Name | 3-methyl-N-[3-[2-(methylamino)-5-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-3-pyridinyl]buta-1,3-dien-2-yl]-4-(4-methylpiperazin-1-yl)pyridin-2-amine |
| SMILES | C=C/C(=C\C(=C/C)c1cnc(NC)c(C(=C)C(=C)Nc2nccc(N3CCN(C)CC3)c2C)c1)NC(=C)CC(C)C |
| InChI | InChI=1S/C34H47N7/c1-11-28(20-30(12-2)38-24(5)19-23(3)4)29-21-31(34(35-9)37-22-29)25(6)27(8)39-33-26(7)32(13-14-36-33)41-17-15-40(10)16-18-41/h11-14,20-23,38H,2,5-6,8,15-19H2,1,3-4,7,9-10H3,(H,35,37)(H,36,39)/b28-11+,30-20+ |
| InChIKey | HZRBOWBRNXFAEK-BQMCQWOZSA-N |
| XLogP | 6.84 |
| TPSA | 68.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.80 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|