C28H24FN3 — CID 145248182
2-[1-[4-(3-fluorophenyl)-1H-indol-2-yl]ethenyl]-4-[(Z)-1-(prop-2-enylideneamino)prop-1-enyl]aniline (PubChem CID 145248182) has the molecular formula C28H24FN3 and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[1-[4-(3-fluorophenyl)-1H-indol-2-yl]ethenyl]-4-[(Z)-1-(prop-2-enylideneamino)prop-1-enyl]aniline.
| Compound Name | 2-[1-[4-(3-fluorophenyl)-1H-indol-2-yl]ethenyl]-4-[(Z)-1-(prop-2-enylideneamino)prop-1-enyl]aniline |
|---|---|
| PubChem CID | 145248182 |
| Molecular Formula | C28H24FN3 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-[1-[4-(3-fluorophenyl)-1H-indol-2-yl]ethenyl]-4-[(Z)-1-(prop-2-enylideneamino)prop-1-enyl]aniline |
| SMILES | C=C/C=N/C(=C\C)c1ccc(N)c(C(=C)c2cc3c(-c4cccc(F)c4)cccc3[nH]2)c1 |
| InChI | InChI=1S/C28H24FN3/c1-4-14-31-26(5-2)20-12-13-25(30)23(16-20)18(3)28-17-24-22(10-7-11-27(24)32-28)19-8-6-9-21(29)15-19/h4-17,32H,1,3,30H2,2H3/b26-5-,31-14+ |
| InChIKey | PNXSQOBCNDWINT-MLGUUPAASA-N |
| XLogP | 7.24 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|