C33H36FN5 — CID 145308449
N-[3-[2-amino-5-[5-(but-1-en-2-ylamino)-3-pyridinyl]phenyl]buta-1,3-dien-2-yl]-5-(3-fluorophenyl)-4-methylpyridin-3-amine;ethane (PubChem CID 145308449) has the molecular formula C33H36FN5 and a molecular weight of 521.68 g/mol. Its IUPAC name is N-[3-[2-amino-5-[5-(but-1-en-2-ylamino)-3-pyridinyl]phenyl]buta-1,3-dien-2-yl]-5-(3-fluorophenyl)-4-methylpyridin-3-amine;ethane.
| Compound Name | N-[3-[2-amino-5-[5-(but-1-en-2-ylamino)-3-pyridinyl]phenyl]buta-1,3-dien-2-yl]-5-(3-fluorophenyl)-4-methylpyridin-3-amine;ethane |
|---|---|
| PubChem CID | 145308449 |
| Molecular Formula | C33H36FN5 |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | N-[3-[2-amino-5-[5-(but-1-en-2-ylamino)-3-pyridinyl]phenyl]buta-1,3-dien-2-yl]-5-(3-fluorophenyl)-4-methylpyridin-3-amine;ethane |
| SMILES | C=C(CC)Nc1cncc(-c2ccc(N)c(C(=C)C(=C)Nc3cncc(-c4cccc(F)c4)c3C)c2)c1.CC |
| InChI | InChI=1S/C31H30FN5.C2H6/c1-6-19(2)36-27-13-25(15-34-16-27)23-10-11-30(33)28(14-23)20(3)22(5)37-31-18-35-17-29(21(31)4)24-8-7-9-26(32)12-24;1-2/h7-18,36-37H,2-3,5-6,33H2,1,4H3;1-2H3 |
| InChIKey | DALOIIMAIMRCDR-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|