C33H36N4S — CID 145254178
(3E,5E)-N-hex-1-en-2-yl-5-[3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine (PubChem CID 145254178) has the molecular formula C33H36N4S and a molecular weight of 520.75 g/mol. Its IUPAC name is (3E,5E)-N-hex-1-en-2-yl-5-[3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N-hex-1-en-2-yl-5-[3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145254178 |
| Molecular Formula | C33H36N4S |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | (3E,5E)-N-hex-1-en-2-yl-5-[3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(/c1cccs1)c1cc(-c2n[nH]c3ccc(C(/C=C(\C=C)NC(=C)CCCC)=C/C)cc23)[nH]c1C |
| InChI | InChI=1S/C33H36N4S/c1-7-11-14-22(5)34-26(10-4)19-24(9-3)25-16-17-30-29(20-25)33(37-36-30)31-21-28(23(6)35-31)27(13-8-2)32-15-12-18-38-32/h8-10,12-13,15-21,34-35H,2,4-5,7,11,14H2,1,3,6H3,(H,36,37)/b24-9+,26-19+,27-13+ |
| InChIKey | LYXLZDRHGSHMBZ-CHAULNRUSA-N |
| XLogP | 9.31 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|