C31H33N5S — CID 145250435
(3E,5E)-N-(3-methylbut-1-en-2-yl)-5-[3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine (PubChem CID 145250435) has the molecular formula C31H33N5S and a molecular weight of 507.71 g/mol. Its IUPAC name is (3E,5E)-N-(3-methylbut-1-en-2-yl)-5-[3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N-(3-methylbut-1-en-2-yl)-5-[3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145250435 |
| Molecular Formula | C31H33N5S |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | (3E,5E)-N-(3-methylbut-1-en-2-yl)-5-[3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(/c1cccs1)c1cc(-c2[nH]nc3ncc(C(/C=C(\C=C)NC(=C)C(C)C)=C/C)cc23)[nH]c1C |
| InChI | InChI=1S/C31H33N5S/c1-8-12-25(29-13-11-14-37-29)26-17-28(34-21(26)7)30-27-16-23(18-32-31(27)36-35-30)22(9-2)15-24(10-3)33-20(6)19(4)5/h8-19,33-34H,1,3,6H2,2,4-5,7H3,(H,32,35,36)/b22-9+,24-15+,25-12+ |
| InChIKey | TZNCHHIYWKJMIJ-GWLPCYKYSA-N |
| XLogP | 8.17 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|