C27H25FN4S — CID 145245529
3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridine (PubChem CID 145245529) has the molecular formula C27H25FN4S and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 145245529 |
| Molecular Formula | C27H25FN4S |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridine |
| SMILES | C=C/C=C(/c1ccc(F)s1)c1cc(-c2[nH]nc3ncc(C(/C=C(/C)C=C)=C/C)cc23)[nH]c1C |
| InChI | InChI=1S/C27H25FN4S/c1-6-9-20(24-10-11-25(28)33-24)21-14-23(30-17(21)5)26-22-13-19(15-29-27(22)32-31-26)18(8-3)12-16(4)7-2/h6-15,30H,1-2H2,3-5H3,(H,29,31,32)/b16-12-,18-8+,20-9+ |
| InChIKey | MRXOYVOONIPZJO-JJCKIWFRSA-N |
| XLogP | 7.62 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|