C29H27FN4 — CID 145249920
3-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridine (PubChem CID 145249920) has the molecular formula C29H27FN4 and a molecular weight of 450.56 g/mol. Its IUPAC name is 3-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridine.
| Compound Name | 3-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 145249920 |
| Molecular Formula | C29H27FN4 |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 3-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridine |
| SMILES | C=C/C=C(/c1cccc(F)c1)c1cc(-c2n[nH]c3ccc(C(/C=C(/C)C=C)=C/C)nc23)[nH]c1C |
| InChI | InChI=1S/C29H27FN4/c1-6-10-23(21-11-9-12-22(30)16-21)24-17-27(31-19(24)5)29-28-26(33-34-29)14-13-25(32-28)20(8-3)15-18(4)7-2/h6-17,31H,1-2H2,3-5H3,(H,33,34)/b18-15-,20-8+,23-10- |
| InChIKey | JLXYKKCPEQHUQG-AUAHZOPKSA-N |
| XLogP | 7.55 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|