C34H37N5 — CID 145251746
5-[(2E,4Z)-5-(cyclohexylmethyl)hepta-2,4,6-trien-3-yl]-3-[5-methyl-4-[(1E)-1-pyridin-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-1H-pyrazolo[4,3-b]pyridine (PubChem CID 145251746) has the molecular formula C34H37N5 and a molecular weight of 515.71 g/mol. Its IUPAC name is 5-[(2E,4Z)-5-(cyclohexylmethyl)hepta-2,4,6-trien-3-yl]-3-[5-methyl-4-[(1E)-1-pyridin-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-1H-pyrazolo[4,3-b]pyridine.
| Compound Name | 5-[(2E,4Z)-5-(cyclohexylmethyl)hepta-2,4,6-trien-3-yl]-3-[5-methyl-4-[(1E)-1-pyridin-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-1H-pyrazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 145251746 |
| Molecular Formula | C34H37N5 |
| Molecular Weight | 515.71 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | 5-[(2E,4Z)-5-(cyclohexylmethyl)hepta-2,4,6-trien-3-yl]-3-[5-methyl-4-[(1E)-1-pyridin-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-1H-pyrazolo[4,3-b]pyridine |
| SMILES | C=C/C=C(/c1ccccn1)c1cc(-c2n[nH]c3ccc(C(/C=C(\C=C)CC4CCCCC4)=C/C)nc23)[nH]c1C |
| InChI | InChI=1S/C34H37N5/c1-5-13-27(30-16-11-12-19-35-30)28-22-32(36-23(28)4)34-33-31(38-39-34)18-17-29(37-33)26(7-3)21-24(6-2)20-25-14-9-8-10-15-25/h5-7,11-13,16-19,21-22,25,36H,1-2,8-10,14-15,20H2,3-4H3,(H,38,39)/b24-21+,26-7+,27-13+ |
| InChIKey | WHYBZGLFQFEZAZ-NFWOWPDLSA-N |
| XLogP | 8.76 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.71 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|