C34H39N3S — CID 145253723
5-[(2Z,4Z)-5-(cyclohexylmethyl)hepta-2,4,6-trien-3-yl]-3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-5,6-dihydro-1H-indazole (PubChem CID 145253723) has the molecular formula C34H39N3S and a molecular weight of 521.77 g/mol. Its IUPAC name is 5-[(2Z,4Z)-5-(cyclohexylmethyl)hepta-2,4,6-trien-3-yl]-3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-5,6-dihydro-1H-indazole.
| Compound Name | 5-[(2Z,4Z)-5-(cyclohexylmethyl)hepta-2,4,6-trien-3-yl]-3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-5,6-dihydro-1H-indazole |
|---|---|
| PubChem CID | 145253723 |
| Molecular Formula | C34H39N3S |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | 5-[(2Z,4Z)-5-(cyclohexylmethyl)hepta-2,4,6-trien-3-yl]-3-[5-methyl-4-[(1E)-1-thiophen-2-ylbuta-1,3-dienyl]-1H-pyrrol-2-yl]-5,6-dihydro-1H-indazole |
| SMILES | C=C/C=C(/c1cccs1)c1cc(-c2n[nH]c3c2=CC(C(/C=C(\C=C)CC2CCCCC2)=C/C)CC=3)[nH]c1C |
| InChI | InChI=1S/C34H39N3S/c1-5-12-28(33-15-11-18-38-33)29-22-32(35-23(29)4)34-30-21-27(16-17-31(30)36-37-34)26(7-3)20-24(6-2)19-25-13-9-8-10-14-25/h5-7,11-12,15,17-18,20-22,25,27,35-36H,1-2,8-10,13-14,16,19H2,3-4H3/b24-20+,26-7+,28-12+ |
| InChIKey | VMKDJCHWPGJXOI-BNJOPKSKSA-N |
| XLogP | 8.00 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|