C27H25FN4OS — CID 137033183
3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4E)-5-methoxyhepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridine (PubChem CID 137033183) has the molecular formula C27H25FN4OS and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4E)-5-methoxyhepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridine.
| Compound Name | 3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4E)-5-methoxyhepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 137033183 |
| Molecular Formula | C27H25FN4OS |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4E)-5-methoxyhepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridine |
| SMILES | C=C/C=C(/c1ccc(F)s1)c1cc(-c2n[nH]c3ccc(C(/C=C(\C=C)OC)=C/C)nc23)[nH]c1C |
| InChI | InChI=1S/C27H25FN4OS/c1-6-9-19(24-12-13-25(28)34-24)20-15-23(29-16(20)4)27-26-22(31-32-27)11-10-21(30-26)17(7-2)14-18(8-3)33-5/h6-15,29H,1,3H2,2,4-5H3,(H,31,32)/b17-7+,18-14+,19-9+ |
| InChIKey | TUSKJUULCVQAPD-FWUONBNWSA-N |
| XLogP | 7.20 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|