C30H32N6S2 — CID 145253447
2-methyl-N-[(3E,5E)-5-[3-[5-methyl-4-[(1E)-1-(5-methylthiophen-2-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-yl]propanethioamide (PubChem CID 145253447) has the molecular formula C30H32N6S2 and a molecular weight of 540.76 g/mol. Its IUPAC name is 2-methyl-N-[(3E,5E)-5-[3-[5-methyl-4-[(1E)-1-(5-methylthiophen-2-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-yl]propanethioamide.
| Compound Name | 2-methyl-N-[(3E,5E)-5-[3-[5-methyl-4-[(1E)-1-(5-methylthiophen-2-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-yl]propanethioamide |
|---|---|
| PubChem CID | 145253447 |
| Molecular Formula | C30H32N6S2 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 2-methyl-N-[(3E,5E)-5-[3-[5-methyl-4-[(1E)-1-(5-methylthiophen-2-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-yl]propanethioamide |
| SMILES | C=C/C=C(/c1ccc(C)s1)c1nc(-c2n[nH]c3ccc(C(/C=C(\C=C)NC(=S)C(C)C)=C/C)nc23)[nH]c1C |
| InChI | InChI=1S/C30H32N6S2/c1-8-11-22(25-15-12-18(6)38-25)26-19(7)31-29(34-26)28-27-24(35-36-28)14-13-23(33-27)20(9-2)16-21(10-3)32-30(37)17(4)5/h8-17H,1,3H2,2,4-7H3,(H,31,34)(H,32,37)(H,35,36)/b20-9+,21-16+,22-11- |
| InChIKey | SXOIHJSJHHYFAY-MVYWKJBJSA-N |
| XLogP | 7.69 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|