C35H41FN4S — CID 145036135
5-fluoro-N-methyl-2-[1-[5-methyl-4-[(1E)-1-(5-methylthiophen-2-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]ethenyl]-4-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]aniline (PubChem CID 145036135) has the molecular formula C35H41FN4S and a molecular weight of 568.81 g/mol. Its IUPAC name is 5-fluoro-N-methyl-2-[1-[5-methyl-4-[(1E)-1-(5-methylthiophen-2-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]ethenyl]-4-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]aniline.
| Compound Name | 5-fluoro-N-methyl-2-[1-[5-methyl-4-[(1E)-1-(5-methylthiophen-2-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]ethenyl]-4-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]aniline |
|---|---|
| PubChem CID | 145036135 |
| Molecular Formula | C35H41FN4S |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 5-fluoro-N-methyl-2-[1-[5-methyl-4-[(1E)-1-(5-methylthiophen-2-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]ethenyl]-4-[(2E,4E)-5-(4-methylpent-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]aniline |
| SMILES | C=C/C=C(/c1ccc(C)s1)c1nc(C(=C)c2cc(C(/C=C(\C=C)NC(=C)CC(C)C)=C/C)c(F)cc2NC)[nH]c1C |
| InChI | InChI=1S/C35H41FN4S/c1-11-14-28(33-16-15-23(7)41-33)34-25(9)39-35(40-34)24(8)29-19-30(31(36)20-32(29)37-10)26(12-2)18-27(13-3)38-22(6)17-21(4)5/h11-16,18-21,37-38H,1,3,6,8,17H2,2,4-5,7,9-10H3,(H,39,40)/b26-12+,27-18+,28-14- |
| InChIKey | OUTNTJDUZNTACM-FWRYLURBSA-N |
| XLogP | 9.57 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|