C30H33FN4 — CID 145034919
(2E,4Z,7Z)-7-(ethenyliminomethyl)-4-[1-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]ethenyl]-N-methyl-6-methylidenenona-2,4,7-trien-3-amine (PubChem CID 145034919) has the molecular formula C30H33FN4 and a molecular weight of 468.62 g/mol. Its IUPAC name is (2E,4Z,7Z)-7-(ethenyliminomethyl)-4-[1-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]ethenyl]-N-methyl-6-methylidenenona-2,4,7-trien-3-amine.
| Compound Name | (2E,4Z,7Z)-7-(ethenyliminomethyl)-4-[1-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]ethenyl]-N-methyl-6-methylidenenona-2,4,7-trien-3-amine |
|---|---|
| PubChem CID | 145034919 |
| Molecular Formula | C30H33FN4 |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (2E,4Z,7Z)-7-(ethenyliminomethyl)-4-[1-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]ethenyl]-N-methyl-6-methylidenenona-2,4,7-trien-3-amine |
| SMILES | C=C/C=C(/c1cccc(F)c1)c1nc(C(=C)C(=C/C(=C)C(=C/C)/C=N/C=C)/C(=C\C)NC)[nH]c1C |
| InChI | InChI=1S/C30H33FN4/c1-9-14-26(24-15-13-16-25(31)18-24)29-22(7)34-30(35-29)21(6)27(28(11-3)32-8)17-20(5)23(10-2)19-33-12-4/h9-19,32H,1,4-6H2,2-3,7-8H3,(H,34,35)/b23-10+,26-14-,27-17-,28-11+,33-19+ |
| InChIKey | JBXGDRICWFDNAV-KHGBAYMKSA-N |
| XLogP | 7.25 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|