C31H34FN5 — CID 145037071
4-[(2E,4E)-5-(but-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-5-fluoro-2-[[5-methyl-4-[(1Z)-1-pyridin-3-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]methyl]aniline (PubChem CID 145037071) has the molecular formula C31H34FN5 and a molecular weight of 495.65 g/mol. Its IUPAC name is 4-[(2E,4E)-5-(but-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-5-fluoro-2-[[5-methyl-4-[(1Z)-1-pyridin-3-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]methyl]aniline.
| Compound Name | 4-[(2E,4E)-5-(but-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-5-fluoro-2-[[5-methyl-4-[(1Z)-1-pyridin-3-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 145037071 |
| Molecular Formula | C31H34FN5 |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 4-[(2E,4E)-5-(but-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]-5-fluoro-2-[[5-methyl-4-[(1Z)-1-pyridin-3-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]methyl]aniline |
| SMILES | C=C/C=C(/c1cccnc1)c1nc(Cc2cc(C(/C=C(\C=C)NC(=C)CC)=C/C)c(F)cc2N)[nH]c1C |
| InChI | InChI=1S/C31H34FN5/c1-7-12-26(23-13-11-14-34-19-23)31-21(6)36-30(37-31)17-24-16-27(28(32)18-29(24)33)22(9-3)15-25(10-4)35-20(5)8-2/h7,9-16,18-19,35H,1,4-5,8,17,33H2,2-3,6H3,(H,36,37)/b22-9+,25-15+,26-12- |
| InChIKey | JDSBOFQVYLSTAJ-PMYAANJYSA-N |
| XLogP | 7.03 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|