C40H51N5 — CID 145036575
acetylene;ethane;2-[[5-methyl-4-[(1E)-1-piperidin-1-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]methyl]-4-[(2E,4E)-5-(3-phenylprop-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]aniline (PubChem CID 145036575) has the molecular formula C40H51N5 and a molecular weight of 601.88 g/mol. Its IUPAC name is acetylene;ethane;2-[[5-methyl-4-[(1E)-1-piperidin-1-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]methyl]-4-[(2E,4E)-5-(3-phenylprop-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]aniline.
| Compound Name | acetylene;ethane;2-[[5-methyl-4-[(1E)-1-piperidin-1-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]methyl]-4-[(2E,4E)-5-(3-phenylprop-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]aniline |
|---|---|
| PubChem CID | 145036575 |
| Molecular Formula | C40H51N5 |
| Molecular Weight | 601.88 g/mol |
| Exact Mass | 601.41 |
| IUPAC Name | acetylene;ethane;2-[[5-methyl-4-[(1E)-1-piperidin-1-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]methyl]-4-[(2E,4E)-5-(3-phenylprop-1-en-2-ylamino)hepta-2,4,6-trien-3-yl]aniline |
| SMILES | C#C.C=C/C=C(\c1nc(Cc2cc(C(/C=C(\C=C)NC(=C)Cc3ccccc3)=C/C)ccc2N)[nH]c1C)N1CCCCC1.CC |
| InChI | InChI=1S/C36H43N5.C2H6.C2H2/c1-6-15-34(41-20-13-10-14-21-41)36-27(5)39-35(40-36)25-31-23-30(18-19-33(31)37)29(7-2)24-32(8-3)38-26(4)22-28-16-11-9-12-17-28;2*1-2/h6-9,11-12,15-19,23-24,38H,1,3-4,10,13-14,20-22,25,37H2,2,5H3,(H,39,40);1-2H3;1-2H/b29-7+,32-24+,34-15+;; |
| InChIKey | QMMXBMUWZUNZJL-SJXYSMFFSA-N |
| XLogP | 9.00 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.88 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|