C25H30N6 — CID 145308611
2-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)-4-[(2E,4E)-5-(4-methylpiperazin-1-yl)hepta-2,4,6-trien-3-yl]aniline (PubChem CID 145308611) has the molecular formula C25H30N6 and a molecular weight of 414.56 g/mol. Its IUPAC name is 2-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)-4-[(2E,4E)-5-(4-methylpiperazin-1-yl)hepta-2,4,6-trien-3-yl]aniline.
| Compound Name | 2-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)-4-[(2E,4E)-5-(4-methylpiperazin-1-yl)hepta-2,4,6-trien-3-yl]aniline |
|---|---|
| PubChem CID | 145308611 |
| Molecular Formula | C25H30N6 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 2-(3H-imidazo[4,5-c]pyridin-2-ylmethyl)-4-[(2E,4E)-5-(4-methylpiperazin-1-yl)hepta-2,4,6-trien-3-yl]aniline |
| SMILES | C=C/C(=C\C(=C/C)c1ccc(N)c(Cc2nc3ccncc3[nH]2)c1)N1CCN(C)CC1 |
| InChI | InChI=1S/C25H30N6/c1-4-18(15-21(5-2)31-12-10-30(3)11-13-31)19-6-7-22(26)20(14-19)16-25-28-23-8-9-27-17-24(23)29-25/h4-9,14-15,17H,2,10-13,16,26H2,1,3H3,(H,28,29)/b18-4+,21-15+ |
| InChIKey | HAJKANPPEJSQNP-CGUQVMIJSA-N |
| XLogP | 3.85 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|