C13H10FN3 — CID 63268921
2-[(2-fluorophenyl)methyl]-3H-imidazo[4,5-c]pyridine (PubChem CID 63268921) has the molecular formula C13H10FN3 and a molecular weight of 227.24 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-3H-imidazo[4,5-c]pyridine.
| Compound Name | 2-[(2-fluorophenyl)methyl]-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 63268921 |
| Molecular Formula | C13H10FN3 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-3H-imidazo[4,5-c]pyridine |
| SMILES | Fc1ccccc1Cc1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C13H10FN3/c14-10-4-2-1-3-9(10)7-13-16-11-5-6-15-8-12(11)17-13/h1-6,8H,7H2,(H,16,17) |
| InChIKey | LCRHROPYOMHUKP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |