C28H25F2N5 — CID 145036018
acetylene;5-[4-amino-2-fluoro-3-[[4-[(1Z)-1-(2-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]phenyl]pyridin-3-amine (PubChem CID 145036018) has the molecular formula C28H25F2N5 and a molecular weight of 469.54 g/mol. Its IUPAC name is acetylene;5-[4-amino-2-fluoro-3-[[4-[(1Z)-1-(2-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]phenyl]pyridin-3-amine.
| Compound Name | acetylene;5-[4-amino-2-fluoro-3-[[4-[(1Z)-1-(2-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 145036018 |
| Molecular Formula | C28H25F2N5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | acetylene;5-[4-amino-2-fluoro-3-[[4-[(1Z)-1-(2-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]phenyl]pyridin-3-amine |
| SMILES | C#C.C=C/C=C(/c1ccccc1F)c1nc(Cc2c(N)ccc(-c3cncc(N)c3)c2F)[nH]c1C |
| InChI | InChI=1S/C26H23F2N5.C2H2/c1-3-6-20(19-7-4-5-8-22(19)27)26-15(2)32-24(33-26)12-21-23(30)10-9-18(25(21)28)16-11-17(29)14-31-13-16;1-2/h3-11,13-14H,1,12,29-30H2,2H3,(H,32,33);1-2H/b20-6-; |
| InChIKey | KRLUUMUVQGNGQS-HHBJSXHRSA-N |
| XLogP | 5.68 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|