C30H29F2N5 — CID 145036918
acetylene;5-[4-amino-2-fluoro-3-[[4-[(1Z)-1-(2-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]phenyl]-N,N-dimethylpyridin-3-amine (PubChem CID 145036918) has the molecular formula C30H29F2N5 and a molecular weight of 497.59 g/mol. Its IUPAC name is acetylene;5-[4-amino-2-fluoro-3-[[4-[(1Z)-1-(2-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]phenyl]-N,N-dimethylpyridin-3-amine.
| Compound Name | acetylene;5-[4-amino-2-fluoro-3-[[4-[(1Z)-1-(2-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]phenyl]-N,N-dimethylpyridin-3-amine |
|---|---|
| PubChem CID | 145036918 |
| Molecular Formula | C30H29F2N5 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | acetylene;5-[4-amino-2-fluoro-3-[[4-[(1Z)-1-(2-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]methyl]phenyl]-N,N-dimethylpyridin-3-amine |
| SMILES | C#C.C=C/C=C(/c1ccccc1F)c1nc(Cc2c(N)ccc(-c3cncc(N(C)C)c3)c2F)[nH]c1C |
| InChI | InChI=1S/C28H27F2N5.C2H2/c1-5-8-22(21-9-6-7-10-24(21)29)28-17(2)33-26(34-28)14-23-25(31)12-11-20(27(23)30)18-13-19(35(3)4)16-32-15-18;1-2/h5-13,15-16H,1,14,31H2,2-4H3,(H,33,34);1-2H/b22-8-; |
| InChIKey | JQBKUUCGKGSDQG-YKIDUCPCSA-N |
| XLogP | 6.16 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|